C38H35BrN4O2 — CID 126326191
6-bromo-2-cyclohexyl-3-[[2,5-dimethyl-1-[4-(naphthalen-1-ylmethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126326191) has the molecular formula C38H35BrN4O2 and a molecular weight of 659.63 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[[2,5-dimethyl-1-[4-(naphthalen-1-ylmethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[[2,5-dimethyl-1-[4-(naphthalen-1-ylmethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126326191 |
| Molecular Formula | C38H35BrN4O2 |
| Molecular Weight | 659.63 g/mol |
| Exact Mass | 658.19 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[[2,5-dimethyl-1-[4-(naphthalen-1-ylmethoxy)phenyl]pyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | Cc1cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)c(C)n1-c1ccc(OCc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C38H35BrN4O2/c1-25-21-30(23-40-43-37(28-10-4-3-5-11-28)41-36-20-15-31(39)22-35(36)38(43)44)26(2)42(25)32-16-18-33(19-17-32)45-24-29-13-8-12-27-9-6-7-14-34(27)29/h6-9,12-23,28H,3-5,10-11,24H2,1-2H3 |
| InChIKey | BEKTVJBPXIEJDA-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.63 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|