C35H33BrClN5O3 — CID 126338261
2-[4-[3-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126338261) has the molecular formula C35H33BrClN5O3 and a molecular weight of 687.04 g/mol. Its IUPAC name is 2-[4-[3-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-[3-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126338261 |
| Molecular Formula | C35H33BrClN5O3 |
| Molecular Weight | 687.04 g/mol |
| Exact Mass | 685.15 |
| IUPAC Name | 2-[4-[3-[(6-bromo-2-cyclohexyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | Cc1cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)c(C)n1-c1ccc(OCC(=O)Nc2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C35H33BrClN5O3/c1-22-18-25(20-38-42-34(24-6-4-3-5-7-24)40-32-17-8-26(36)19-31(32)35(42)44)23(2)41(22)29-13-15-30(16-14-29)45-21-33(43)39-28-11-9-27(37)10-12-28/h8-20,24H,3-7,21H2,1-2H3,(H,39,43) |
| InChIKey | GCPSPALPIZFLGC-UHFFFAOYSA-N |
| XLogP | 8.17 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 687.04 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|