C31H27BrClN5O3 — CID 126305344
2-[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide (PubChem CID 126305344) has the molecular formula C31H27BrClN5O3 and a molecular weight of 632.95 g/mol. Its IUPAC name is 2-[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide.
| Compound Name | 2-[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide |
|---|---|
| PubChem CID | 126305344 |
| Molecular Formula | C31H27BrClN5O3 |
| Molecular Weight | 632.95 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | 2-[4-[3-[(6-bromo-2-ethyl-4-oxoquinazolin-3-yl)iminomethyl]-2,5-dimethylpyrrol-1-yl]phenoxy]-N-(4-chlorophenyl)acetamide |
| SMILES | CCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCC(=O)Nc3ccc(Cl)cc3)cc2)c1C |
| InChI | InChI=1S/C31H27BrClN5O3/c1-4-29-36-28-14-5-22(32)16-27(28)31(40)38(29)34-17-21-15-19(2)37(20(21)3)25-10-12-26(13-11-25)41-18-30(39)35-24-8-6-23(33)7-9-24/h5-17H,4,18H2,1-3H3,(H,35,39) |
| InChIKey | YYDAWMYRSRZXRL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 90.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.95 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|