C31H35BrN4O — CID 126330245
6-bromo-3-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126330245) has the molecular formula C31H35BrN4O and a molecular weight of 559.55 g/mol. Its IUPAC name is 6-bromo-3-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126330245 |
| Molecular Formula | C31H35BrN4O |
| Molecular Weight | 559.55 g/mol |
| Exact Mass | 558.20 |
| IUPAC Name | 6-bromo-3-[[1-(4-butylphenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | CCCCc1ccc(-n2c(C)cc(C=Nn3c(C4CCCCC4)nc4ccc(Br)cc4c3=O)c2C)cc1 |
| InChI | InChI=1S/C31H35BrN4O/c1-4-5-9-23-12-15-27(16-13-23)35-21(2)18-25(22(35)3)20-33-36-30(24-10-7-6-8-11-24)34-29-17-14-26(32)19-28(29)31(36)37/h12-20,24H,4-11H2,1-3H3 |
| InChIKey | SDDVMGJALDRSRV-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.55 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|