C32H30BrFN4O2 — CID 126323198
6-bromo-2-butyl-3-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one (PubChem CID 126323198) has the molecular formula C32H30BrFN4O2 and a molecular weight of 601.52 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323198 |
| Molecular Formula | C32H30BrFN4O2 |
| Molecular Weight | 601.52 g/mol |
| Exact Mass | 600.15 |
| IUPAC Name | 6-bromo-2-butyl-3-[[1-[4-[(4-fluorophenyl)methoxy]phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCc3ccc(F)cc3)cc2)c1C |
| InChI | InChI=1S/C32H30BrFN4O2/c1-4-5-6-31-36-30-16-9-25(33)18-29(30)32(39)38(31)35-19-24-17-21(2)37(22(24)3)27-12-14-28(15-13-27)40-20-23-7-10-26(34)11-8-23/h7-19H,4-6,20H2,1-3H3 |
| InChIKey | NRXYGLBRDLZGOM-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.52 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|