C29H33BrN4O2 — CID 126316175
6-bromo-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126316175) has the molecular formula C29H33BrN4O2 and a molecular weight of 549.51 g/mol. Its IUPAC name is 6-bromo-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126316175 |
| Molecular Formula | C29H33BrN4O2 |
| Molecular Weight | 549.51 g/mol |
| Exact Mass | 548.18 |
| IUPAC Name | 6-bromo-3-[[1-[4-(2,2-dimethylpropoxy)phenyl]-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(OCC(C)(C)C)cc2)c1C |
| InChI | InChI=1S/C29H33BrN4O2/c1-7-8-27-32-26-14-9-22(30)16-25(26)28(35)34(27)31-17-21-15-19(2)33(20(21)3)23-10-12-24(13-11-23)36-18-29(4,5)6/h9-17H,7-8,18H2,1-6H3 |
| InChIKey | PEMBEIQAACROFD-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 61.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.51 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|