C24H21BrCl2N4O — CID 126306877
6-bromo-3-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126306877) has the molecular formula C24H21BrCl2N4O and a molecular weight of 532.27 g/mol. Its IUPAC name is 6-bromo-3-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126306877 |
| Molecular Formula | C24H21BrCl2N4O |
| Molecular Weight | 532.27 g/mol |
| Exact Mass | 530.03 |
| IUPAC Name | 6-bromo-3-[[1-(2,4-dichlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(C)n(-c2ccc(Cl)cc2Cl)c1C |
| InChI | InChI=1S/C24H21BrCl2N4O/c1-4-5-23-29-21-8-6-17(25)11-19(21)24(32)31(23)28-13-16-10-14(2)30(15(16)3)22-9-7-18(26)12-20(22)27/h6-13H,4-5H2,1-3H3 |
| InChIKey | ALACAKPXTIRLOU-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 52.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.27 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|