C20H18BrCl2N3O2 — CID 126328898
6-bromo-3-[(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126328898) has the molecular formula C20H18BrCl2N3O2 and a molecular weight of 483.19 g/mol. Its IUPAC name is 6-bromo-3-[(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126328898 |
| Molecular Formula | C20H18BrCl2N3O2 |
| Molecular Weight | 483.19 g/mol |
| Exact Mass | 481.00 |
| IUPAC Name | 6-bromo-3-[(3,5-dichloro-4-ethoxyphenyl)methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(OCC)c(Cl)c1 |
| InChI | InChI=1S/C20H18BrCl2N3O2/c1-3-5-18-25-17-7-6-13(21)10-14(17)20(27)26(18)24-11-12-8-15(22)19(28-4-2)16(23)9-12/h6-11H,3-5H2,1-2H3 |
| InChIKey | KUEYTOAZOGKKGL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.19 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|