C21H20BrI2N3O2 — CID 126323473
6-bromo-2-butyl-3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126323473) has the molecular formula C21H20BrI2N3O2 and a molecular weight of 680.12 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323473 |
| Molecular Formula | C21H20BrI2N3O2 |
| Molecular Weight | 680.12 g/mol |
| Exact Mass | 678.88 |
| IUPAC Name | 6-bromo-2-butyl-3-[(4-ethoxy-3,5-diiodophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(OCC)c(I)c1 |
| InChI | InChI=1S/C21H20BrI2N3O2/c1-3-5-6-19-26-18-8-7-14(22)11-15(18)21(28)27(19)25-12-13-9-16(23)20(29-4-2)17(24)10-13/h7-12H,3-6H2,1-2H3 |
| InChIKey | OYPSNUBFAIKDSE-UHFFFAOYSA-N |
| XLogP | 5.99 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.12 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|