C24H26BrI2N3O2 — CID 126329527
6-bromo-2-butyl-3-[[4-(2,2-dimethylpropoxy)-3,5-diiodophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126329527) has the molecular formula C24H26BrI2N3O2 and a molecular weight of 722.20 g/mol. Its IUPAC name is 6-bromo-2-butyl-3-[[4-(2,2-dimethylpropoxy)-3,5-diiodophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-butyl-3-[[4-(2,2-dimethylpropoxy)-3,5-diiodophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126329527 |
| Molecular Formula | C24H26BrI2N3O2 |
| Molecular Weight | 722.20 g/mol |
| Exact Mass | 720.93 |
| IUPAC Name | 6-bromo-2-butyl-3-[[4-(2,2-dimethylpropoxy)-3,5-diiodophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(OCC(C)(C)C)c(I)c1 |
| InChI | InChI=1S/C24H26BrI2N3O2/c1-5-6-7-21-29-20-9-8-16(25)12-17(20)23(31)30(21)28-13-15-10-18(26)22(19(27)11-15)32-14-24(2,3)4/h8-13H,5-7,14H2,1-4H3 |
| InChIKey | NYBDOACECUFBHZ-UHFFFAOYSA-N |
| XLogP | 7.02 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 722.20 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|