C18H14BrCl2N3O — CID 126322458
6-bromo-3-[(3,4-dichlorophenyl)methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126322458) has the molecular formula C18H14BrCl2N3O and a molecular weight of 439.14 g/mol. Its IUPAC name is 6-bromo-3-[(3,4-dichlorophenyl)methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3,4-dichlorophenyl)methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126322458 |
| Molecular Formula | C18H14BrCl2N3O |
| Molecular Weight | 439.14 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 6-bromo-3-[(3,4-dichlorophenyl)methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C18H14BrCl2N3O/c1-2-3-17-23-16-7-5-12(19)9-13(16)18(25)24(17)22-10-11-4-6-14(20)15(21)8-11/h4-10H,2-3H2,1H3 |
| InChIKey | PTIBPAIQIBLKPQ-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.14 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|