C22H22BrCl2N3O2 — CID 126343424
6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126343424) has the molecular formula C22H22BrCl2N3O2 and a molecular weight of 511.25 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126343424 |
| Molecular Formula | C22H22BrCl2N3O2 |
| Molecular Weight | 511.25 g/mol |
| Exact Mass | 509.03 |
| IUPAC Name | 6-bromo-3-[[4-[(2S)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(O[C@@H](C)CC)c(Cl)c1 |
| InChI | InChI=1S/C22H22BrCl2N3O2/c1-4-6-20-27-19-8-7-15(23)11-16(19)22(29)28(20)26-12-14-9-17(24)21(18(25)10-14)30-13(3)5-2/h7-13H,4-6H2,1-3H3/t13-/m0/s1 |
| InChIKey | XPXKKPAVXURWHU-ZDUSSCGKSA-N |
| XLogP | 6.48 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.25 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|