C23H24BrCl2N3O2 — CID 126325202
6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126325202) has the molecular formula C23H24BrCl2N3O2 and a molecular weight of 525.27 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126325202 |
| Molecular Formula | C23H24BrCl2N3O2 |
| Molecular Weight | 525.27 g/mol |
| Exact Mass | 523.04 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(2R)-butan-2-yl]oxy-3,5-dichlorophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)Oc1c(Cl)cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc1Cl |
| InChI | InChI=1S/C23H24BrCl2N3O2/c1-5-13(3)22-28-20-8-7-16(24)11-17(20)23(30)29(22)27-12-15-9-18(25)21(19(26)10-15)31-14(4)6-2/h7-14H,5-6H2,1-4H3/t13-,14+/m0/s1 |
| InChIKey | ZOHXZHZSKPGVFF-UONOGXRCSA-N |
| XLogP | 7.04 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.27 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|