C23H22BrCl2N3O4 — CID 126321876
ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]acetate (PubChem CID 126321876) has the molecular formula C23H22BrCl2N3O4 and a molecular weight of 555.26 g/mol. Its IUPAC name is ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]acetate.
| Compound Name | ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]acetate |
|---|---|
| PubChem CID | 126321876 |
| Molecular Formula | C23H22BrCl2N3O4 |
| Molecular Weight | 555.26 g/mol |
| Exact Mass | 553.02 |
| IUPAC Name | ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dichlorophenoxy]acetate |
| SMILES | CCOC(=O)COc1c(Cl)cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc1Cl |
| InChI | InChI=1S/C23H22BrCl2N3O4/c1-4-13(3)22-28-19-7-6-15(24)10-16(19)23(31)29(22)27-11-14-8-17(25)21(18(26)9-14)33-12-20(30)32-5-2/h6-11,13H,4-5,12H2,1-3H3/t13-/m0/s1 |
| InChIKey | WPYGITZMXXNMSQ-ZDUSSCGKSA-N |
| XLogP | 5.80 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.26 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|