C25H28BrN3O6 — CID 126319489
ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]acetate (PubChem CID 126319489) has the molecular formula C25H28BrN3O6 and a molecular weight of 546.42 g/mol. Its IUPAC name is ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]acetate.
| Compound Name | ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]acetate |
|---|---|
| PubChem CID | 126319489 |
| Molecular Formula | C25H28BrN3O6 |
| Molecular Weight | 546.42 g/mol |
| Exact Mass | 545.12 |
| IUPAC Name | ethyl 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2,6-dimethoxyphenoxy]acetate |
| SMILES | CCOC(=O)COc1c(OC)cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc1OC |
| InChI | InChI=1S/C25H28BrN3O6/c1-6-15(3)24-28-19-9-8-17(26)12-18(19)25(31)29(24)27-13-16-10-20(32-4)23(21(11-16)33-5)35-14-22(30)34-7-2/h8-13,15H,6-7,14H2,1-5H3/t15-/m0/s1 |
| InChIKey | BOLLCUHVESKODF-HNNXBMFYSA-N |
| XLogP | 4.51 |
| TPSA | 101.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.42 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|