C22H22BrN5O6 — CID 126342907
2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide (PubChem CID 126342907) has the molecular formula C22H22BrN5O6 and a molecular weight of 532.35 g/mol. Its IUPAC name is 2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide.
| Compound Name | 2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide |
|---|---|
| PubChem CID | 126342907 |
| Molecular Formula | C22H22BrN5O6 |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 531.08 |
| IUPAC Name | 2-[4-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-methoxy-6-nitrophenoxy]acetamide |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(OCC(N)=O)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H22BrN5O6/c1-4-12(2)21-26-16-6-5-14(23)9-15(16)22(30)27(21)25-10-13-7-17(28(31)32)20(18(8-13)33-3)34-11-19(24)29/h5-10,12H,4,11H2,1-3H3,(H2,24,29)/t12-/m1/s1 |
| InChIKey | UQJDUQKMUHWRHK-GFCCVEGCSA-N |
| XLogP | 3.34 |
| TPSA | 151.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|