C23H22BrN5O5 — CID 126330682
2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]acetonitrile (PubChem CID 126330682) has the molecular formula C23H22BrN5O5 and a molecular weight of 528.36 g/mol. Its IUPAC name is 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]acetonitrile.
| Compound Name | 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]acetonitrile |
|---|---|
| PubChem CID | 126330682 |
| Molecular Formula | C23H22BrN5O5 |
| Molecular Weight | 528.36 g/mol |
| Exact Mass | 527.08 |
| IUPAC Name | 2-[4-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-2-ethoxy-6-nitrophenoxy]acetonitrile |
| SMILES | CCOc1cc(C=Nn2c([C@@H](C)CC)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OCC#N |
| InChI | InChI=1S/C23H22BrN5O5/c1-4-14(3)22-27-18-7-6-16(24)12-17(18)23(30)28(22)26-13-15-10-19(29(31)32)21(34-9-8-25)20(11-15)33-5-2/h6-7,10-14H,4-5,9H2,1-3H3/t14-/m0/s1 |
| InChIKey | URNFLHVYJXYABX-AWEZNQCLSA-N |
| XLogP | 4.76 |
| TPSA | 132.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.36 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|