C20H19BrN4O5 — CID 126291909
6-bromo-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126291909) has the molecular formula C20H19BrN4O5 and a molecular weight of 475.30 g/mol. Its IUPAC name is 6-bromo-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126291909 |
| Molecular Formula | C20H19BrN4O5 |
| Molecular Weight | 475.30 g/mol |
| Exact Mass | 474.05 |
| IUPAC Name | 6-bromo-3-[(3,4-diethoxy-5-nitrophenyl)methylideneamino]-2-methylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C20H19BrN4O5/c1-4-29-18-9-13(8-17(25(27)28)19(18)30-5-2)11-22-24-12(3)23-16-7-6-14(21)10-15(16)20(24)26/h6-11H,4-5H2,1-3H3 |
| InChIKey | XCSXKXDPYIHLEW-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.30 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|