C24H18BrN5O7 — CID 126299078
6-bromo-3-[[3-methoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126299078) has the molecular formula C24H18BrN5O7 and a molecular weight of 568.34 g/mol. Its IUPAC name is 6-bromo-3-[[3-methoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-methoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126299078 |
| Molecular Formula | C24H18BrN5O7 |
| Molecular Weight | 568.34 g/mol |
| Exact Mass | 567.04 |
| IUPAC Name | 6-bromo-3-[[3-methoxy-5-nitro-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C)nc3ccc(Br)cc3c2=O)cc([N+](=O)[O-])c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C24H18BrN5O7/c1-14-27-20-7-6-17(25)11-19(20)24(31)28(14)26-12-16-9-21(30(34)35)23(22(10-16)36-2)37-13-15-4-3-5-18(8-15)29(32)33/h3-12H,13H2,1-2H3 |
| InChIKey | VXOXEKCBVWUXFB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 151.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.34 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|