C23H15Br2N5O6 — CID 126292484
6-bromo-3-[[3-bromo-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one (PubChem CID 126292484) has the molecular formula C23H15Br2N5O6 and a molecular weight of 617.21 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
|---|---|
| PubChem CID | 126292484 |
| Molecular Formula | C23H15Br2N5O6 |
| Molecular Weight | 617.21 g/mol |
| Exact Mass | 614.94 |
| IUPAC Name | 6-bromo-3-[[3-bromo-5-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-methylquinazolin-4-one |
| SMILES | Cc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)c(OCc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H15Br2N5O6/c1-13-27-20-7-4-16(24)10-18(20)23(31)28(13)26-11-15-8-19(25)22(21(9-15)30(34)35)36-12-14-2-5-17(6-3-14)29(32)33/h2-11H,12H2,1H3 |
| InChIKey | PTDHVPCQKDSALJ-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 142.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.21 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|