C26H21Br3N4O4 — CID 126321492
6-bromo-3-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one (PubChem CID 126321492) has the molecular formula C26H21Br3N4O4 and a molecular weight of 693.19 g/mol. Its IUPAC name is 6-bromo-3-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126321492 |
| Molecular Formula | C26H21Br3N4O4 |
| Molecular Weight | 693.19 g/mol |
| Exact Mass | 689.91 |
| IUPAC Name | 6-bromo-3-[[3-bromo-4-[(4-bromophenyl)methoxy]-5-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)c(OCc2ccc(Br)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H21Br3N4O4/c1-3-15(2)25-31-22-9-8-19(28)12-20(22)26(34)32(25)30-13-17-10-21(29)24(23(11-17)33(35)36)37-14-16-4-6-18(27)7-5-16/h4-13,15H,3,14H2,1-2H3/t15-/m0/s1 |
| InChIKey | UZUIGQHGWYQQPC-HNNXBMFYSA-N |
| XLogP | 7.57 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 693.19 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|