C26H21BrCl2N4O4 — CID 126318493
6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126318493) has the molecular formula C26H21BrCl2N4O4 and a molecular weight of 604.29 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126318493 |
| Molecular Formula | C26H21BrCl2N4O4 |
| Molecular Weight | 604.29 g/mol |
| Exact Mass | 602.01 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(OCc2ccc([N+](=O)[O-])cc2)c(Cl)c1 |
| InChI | InChI=1S/C26H21BrCl2N4O4/c1-3-15(2)25-31-23-9-6-18(27)12-20(23)26(34)32(25)30-13-17-10-21(28)24(22(29)11-17)37-14-16-4-7-19(8-5-16)33(35)36/h4-13,15H,3,14H2,1-2H3/t15-/m1/s1 |
| InChIKey | KNZIFBWSLWRNPX-OAHLLOKOSA-N |
| XLogP | 7.35 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.29 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|