C24H18BrCl2N5O4 — CID 126320463
6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126320463) has the molecular formula C24H18BrCl2N5O4 and a molecular weight of 591.25 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126320463 |
| Molecular Formula | C24H18BrCl2N5O4 |
| Molecular Weight | 591.25 g/mol |
| Exact Mass | 588.99 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dichloro-4-[(5-nitro-2-pyridinyl)oxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Cl)c(Oc2ccc([N+](=O)[O-])cn2)c(Cl)c1 |
| InChI | InChI=1S/C24H18BrCl2N5O4/c1-3-13(2)23-30-20-6-4-15(25)10-17(20)24(33)31(23)29-11-14-8-18(26)22(19(27)9-14)36-21-7-5-16(12-28-21)32(34)35/h4-13H,3H2,1-2H3/t13-/m1/s1 |
| InChIKey | FSKIXVGGLKKXDT-CYBMUJFWSA-N |
| XLogP | 6.96 |
| TPSA | 112.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.25 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|