C21H21BrN4O4 — CID 126324802
6-bromo-2-[(2R)-butan-2-yl]-3-[(2-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one (PubChem CID 126324802) has the molecular formula C21H21BrN4O4 and a molecular weight of 473.33 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[(2-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126324802 |
| Molecular Formula | C21H21BrN4O4 |
| Molecular Weight | 473.33 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[(2-ethoxy-5-nitrophenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1ccc([N+](=O)[O-])cc1C=Nn1c([C@H](C)CC)nc2ccc(Br)cc2c1=O |
| InChI | InChI=1S/C21H21BrN4O4/c1-4-13(3)20-24-18-8-6-15(22)11-17(18)21(27)25(20)23-12-14-10-16(26(28)29)7-9-19(14)30-5-2/h6-13H,4-5H2,1-3H3/t13-/m1/s1 |
| InChIKey | WQSROWLQSUSCRH-CYBMUJFWSA-N |
| XLogP | 4.86 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.33 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|