C25H20BrN5O6 — CID 126305087
6-bromo-3-[[5-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one (PubChem CID 126305087) has the molecular formula C25H20BrN5O6 and a molecular weight of 566.37 g/mol. Its IUPAC name is 6-bromo-3-[[5-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one |
|---|---|
| PubChem CID | 126305087 |
| Molecular Formula | C25H20BrN5O6 |
| Molecular Weight | 566.37 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | 6-bromo-3-[[5-nitro-2-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]-2-propan-2-ylquinazolin-4-one |
| SMILES | CC(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc([N+](=O)[O-])ccc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C25H20BrN5O6/c1-15(2)24-28-22-8-6-18(26)12-21(22)25(32)29(24)27-13-17-11-20(31(35)36)7-9-23(17)37-14-16-4-3-5-19(10-16)30(33)34/h3-13,15H,14H2,1-2H3 |
| InChIKey | OIFDHKPBBDMIQT-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 142.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.37 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|