C27H23BrN4O6 — CID 126317672
3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]methyl]benzoic acid (PubChem CID 126317672) has the molecular formula C27H23BrN4O6 and a molecular weight of 579.41 g/mol. Its IUPAC name is 3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]methyl]benzoic acid.
| Compound Name | 3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]methyl]benzoic acid |
|---|---|
| PubChem CID | 126317672 |
| Molecular Formula | C27H23BrN4O6 |
| Molecular Weight | 579.41 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 3-[[2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]methyl]benzoic acid |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc([N+](=O)[O-])ccc1OCc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C27H23BrN4O6/c1-3-16(2)25-30-23-9-7-20(28)13-22(23)26(33)31(25)29-14-19-12-21(32(36)37)8-10-24(19)38-15-17-5-4-6-18(11-17)27(34)35/h4-14,16H,3,15H2,1-2H3,(H,34,35)/t16-/m1/s1 |
| InChIKey | GSRULUTYLRNCAT-MRXNPFEDSA-N |
| XLogP | 5.74 |
| TPSA | 136.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.41 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|