C27H24BrN5O5 — CID 126323045
2-[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]-N-phenylacetamide (PubChem CID 126323045) has the molecular formula C27H24BrN5O5 and a molecular weight of 578.42 g/mol. Its IUPAC name is 2-[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]-N-phenylacetamide.
| Compound Name | 2-[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]-N-phenylacetamide |
|---|---|
| PubChem CID | 126323045 |
| Molecular Formula | C27H24BrN5O5 |
| Molecular Weight | 578.42 g/mol |
| Exact Mass | 577.10 |
| IUPAC Name | 2-[2-[[6-bromo-2-[(2S)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-4-nitrophenoxy]-N-phenylacetamide |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc([N+](=O)[O-])ccc1OCC(=O)Nc1ccccc1 |
| InChI | InChI=1S/C27H24BrN5O5/c1-3-17(2)26-31-23-11-9-19(28)14-22(23)27(35)32(26)29-15-18-13-21(33(36)37)10-12-24(18)38-16-25(34)30-20-7-5-4-6-8-20/h4-15,17H,3,16H2,1-2H3,(H,30,34)/t17-/m0/s1 |
| InChIKey | NPSIIZUJOKYYTG-KRWDZBQOSA-N |
| XLogP | 5.48 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.42 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|