C28H25Br2N5O5 — CID 126316573
2-[4-bromo-2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126316573) has the molecular formula C28H25Br2N5O5 and a molecular weight of 671.35 g/mol. Its IUPAC name is 2-[4-bromo-2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-bromo-2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126316573 |
| Molecular Formula | C28H25Br2N5O5 |
| Molecular Weight | 671.35 g/mol |
| Exact Mass | 669.02 |
| IUPAC Name | 2-[4-bromo-2-[[6-bromo-2-[(2R)-butan-2-yl]-4-oxoquinazolin-3-yl]iminomethyl]-6-nitrophenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C28H25Br2N5O5/c1-4-17(3)27-33-23-10-7-19(29)12-22(23)28(37)34(27)31-14-18-11-20(30)13-24(35(38)39)26(18)40-15-25(36)32-21-8-5-16(2)6-9-21/h5-14,17H,4,15H2,1-3H3,(H,32,36)/t17-/m1/s1 |
| InChIKey | ACFWNWZPCMIFCJ-QGZVFWFLSA-N |
| XLogP | 6.55 |
| TPSA | 128.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 671.35 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|