C24H26Br2N4O4 — CID 126322370
6-bromo-3-[[5-bromo-2-(2,2-dimethylpropoxy)-3-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one (PubChem CID 126322370) has the molecular formula C24H26Br2N4O4 and a molecular weight of 594.30 g/mol. Its IUPAC name is 6-bromo-3-[[5-bromo-2-(2,2-dimethylpropoxy)-3-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one.
| Compound Name | 6-bromo-3-[[5-bromo-2-(2,2-dimethylpropoxy)-3-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one |
|---|---|
| PubChem CID | 126322370 |
| Molecular Formula | C24H26Br2N4O4 |
| Molecular Weight | 594.30 g/mol |
| Exact Mass | 592.03 |
| IUPAC Name | 6-bromo-3-[[5-bromo-2-(2,2-dimethylpropoxy)-3-nitrophenyl]methylideneamino]-2-[(2S)-butan-2-yl]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)cc([N+](=O)[O-])c1OCC(C)(C)C |
| InChI | InChI=1S/C24H26Br2N4O4/c1-6-14(2)22-28-19-8-7-16(25)10-18(19)23(31)29(22)27-12-15-9-17(26)11-20(30(32)33)21(15)34-13-24(3,4)5/h7-12,14H,6,13H2,1-5H3/t14-/m0/s1 |
| InChIKey | XZJIATRQFVQYMJ-AWEZNQCLSA-N |
| XLogP | 6.65 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.30 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|