C28H27BrN4O6 — CID 126336549
6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dimethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126336549) has the molecular formula C28H27BrN4O6 and a molecular weight of 595.45 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dimethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dimethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126336549 |
| Molecular Formula | C28H27BrN4O6 |
| Molecular Weight | 595.45 g/mol |
| Exact Mass | 594.11 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[3,5-dimethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OC)c(OCc2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C28H27BrN4O6/c1-5-17(2)27-31-23-11-8-20(29)14-22(23)28(34)32(27)30-15-19-12-24(37-3)26(25(13-19)38-4)39-16-18-6-9-21(10-7-18)33(35)36/h6-15,17H,5,16H2,1-4H3/t17-/m1/s1 |
| InChIKey | ADYXFXVIOFDUJG-QGZVFWFLSA-N |
| XLogP | 6.06 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.45 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|