C26H22BrClN4O4 — CID 126326158
6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126326158) has the molecular formula C26H22BrClN4O4 and a molecular weight of 569.84 g/mol. Its IUPAC name is 6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126326158 |
| Molecular Formula | C26H22BrClN4O4 |
| Molecular Weight | 569.84 g/mol |
| Exact Mass | 568.05 |
| IUPAC Name | 6-bromo-2-[(2R)-butan-2-yl]-3-[[4-[(4-chlorophenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc(Cl)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22BrClN4O4/c1-3-16(2)25-30-22-10-7-19(27)13-21(22)26(33)31(25)29-14-18-6-11-24(23(12-18)32(34)35)36-15-17-4-8-20(28)9-5-17/h4-14,16H,3,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | ATJLEEJLOBGMKO-MRXNPFEDSA-N |
| XLogP | 6.70 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.84 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|