C27H25BrN4O4 — CID 126317397
6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one (PubChem CID 126317397) has the molecular formula C27H25BrN4O4 and a molecular weight of 549.43 g/mol. Its IUPAC name is 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126317397 |
| Molecular Formula | C27H25BrN4O4 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | 6-bromo-2-[(2S)-butan-2-yl]-3-[[4-[(4-methylphenyl)methoxy]-3-nitrophenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC[C@H](C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc(C)cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H25BrN4O4/c1-4-18(3)26-30-23-11-10-21(28)14-22(23)27(33)31(26)29-15-20-9-12-25(24(13-20)32(34)35)36-16-19-7-5-17(2)6-8-19/h5-15,18H,4,16H2,1-3H3/t18-/m0/s1 |
| InChIKey | YXZKYKMXRNVVNE-SFHVURJKSA-N |
| XLogP | 6.35 |
| TPSA | 99.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|