C26H22BrN5O6 — CID 126298469
6-bromo-2-tert-butyl-3-[[3-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126298469) has the molecular formula C26H22BrN5O6 and a molecular weight of 580.40 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[[3-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[[3-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126298469 |
| Molecular Formula | C26H22BrN5O6 |
| Molecular Weight | 580.40 g/mol |
| Exact Mass | 579.08 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[[3-nitro-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | CC(C)(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C26H22BrN5O6/c1-26(2,3)25-29-21-10-7-18(27)13-20(21)24(33)30(25)28-14-17-6-11-23(22(12-17)32(36)37)38-15-16-4-8-19(9-5-16)31(34)35/h4-14H,15H2,1-3H3 |
| InChIKey | GDRZHESLBIVBIG-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 142.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.40 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|