C28H25Br2ClN4O5 — CID 126304218
6-bromo-3-[[2-bromo-3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one (PubChem CID 126304218) has the molecular formula C28H25Br2ClN4O5 and a molecular weight of 692.79 g/mol. Its IUPAC name is 6-bromo-3-[[2-bromo-3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[2-bromo-3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126304218 |
| Molecular Formula | C28H25Br2ClN4O5 |
| Molecular Weight | 692.79 g/mol |
| Exact Mass | 689.99 |
| IUPAC Name | 6-bromo-3-[[2-bromo-3-chloro-5-ethoxy-4-[(4-nitrophenyl)methoxy]phenyl]methylideneamino]-2-tert-butylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)c(Br)c(Cl)c1OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C28H25Br2ClN4O5/c1-5-39-22-12-17(23(30)24(31)25(22)40-15-16-6-9-19(10-7-16)35(37)38)14-32-34-26(36)20-13-18(29)8-11-21(20)33-27(34)28(2,3)4/h6-14H,5,15H2,1-4H3 |
| InChIKey | VUEKBALXKRTOGG-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.79 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|