C27H23Br3N4O5 — CID 126284899
6-bromo-2-tert-butyl-3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one (PubChem CID 126284899) has the molecular formula C27H23Br3N4O5 and a molecular weight of 723.22 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126284899 |
| Molecular Formula | C27H23Br3N4O5 |
| Molecular Weight | 723.22 g/mol |
| Exact Mass | 719.92 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[[2,3-dibromo-5-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)c(Br)c(Br)c1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H23Br3N4O5/c1-27(2,3)26-32-20-9-8-17(28)12-19(20)25(35)33(26)31-13-16-11-21(38-4)24(23(30)22(16)29)39-14-15-6-5-7-18(10-15)34(36)37/h5-13H,14H2,1-4H3 |
| InChIKey | GPJAJJJROUNPAV-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 108.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 723.22 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|