C27H23BrN4O6 — CID 126288200
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one (PubChem CID 126288200) has the molecular formula C27H23BrN4O6 and a molecular weight of 579.41 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126288200 |
| Molecular Formula | C27H23BrN4O6 |
| Molecular Weight | 579.41 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-nitrophenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
| SMILES | CC(C)(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc3c(c2)OCO3)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H23BrN4O6/c1-27(2,3)26-30-20-7-6-18(28)12-19(20)25(33)31(26)29-13-16-4-8-22(21(10-16)32(34)35)36-14-17-5-9-23-24(11-17)38-15-37-23/h4-13H,14-15H2,1-3H3 |
| InChIKey | NYVRAGVTBOCGAW-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 118.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.41 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|