C27H24BrN3O4 — CID 126312192
3-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one (PubChem CID 126312192) has the molecular formula C27H24BrN3O4 and a molecular weight of 534.41 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126312192 |
| Molecular Formula | C27H24BrN3O4 |
| Molecular Weight | 534.41 g/mol |
| Exact Mass | 533.10 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)phenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
| SMILES | CC(C)(C)c1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(OCc2ccc3c(c2)OCO3)cc1 |
| InChI | InChI=1S/C27H24BrN3O4/c1-27(2,3)26-30-22-10-7-19(28)13-21(22)25(32)31(26)29-14-17-4-8-20(9-5-17)33-15-18-6-11-23-24(12-18)35-16-34-23/h4-14H,15-16H2,1-3H3 |
| InChIKey | OZPBCZAIOLHARY-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 74.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|