C32H32BrN3O5 — CID 126305487
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one (PubChem CID 126305487) has the molecular formula C32H32BrN3O5 and a molecular weight of 618.53 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126305487 |
| Molecular Formula | C32H32BrN3O5 |
| Molecular Weight | 618.53 g/mol |
| Exact Mass | 617.15 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-prop-2-enylphenyl]methylideneamino]-6-bromo-2-tert-butylquinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(OCC)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C32H32BrN3O5/c1-6-8-22-13-21(15-28(38-7-2)29(22)39-18-20-9-12-26-27(14-20)41-19-40-26)17-34-36-30(37)24-16-23(33)10-11-25(24)35-31(36)32(3,4)5/h6,9-17H,1,7-8,18-19H2,2-5H3 |
| InChIKey | ZJIQTDGPJIGEJI-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 618.53 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|