C31H32BrN3O3 — CID 126299211
6-bromo-2-tert-butyl-3-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126299211) has the molecular formula C31H32BrN3O3 and a molecular weight of 574.52 g/mol. Its IUPAC name is 6-bromo-2-tert-butyl-3-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-tert-butyl-3-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126299211 |
| Molecular Formula | C31H32BrN3O3 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 573.16 |
| IUPAC Name | 6-bromo-2-tert-butyl-3-[(3-ethoxy-4-phenylmethoxy-5-prop-2-enylphenyl)methylideneamino]quinazolin-4-one |
| SMILES | C=CCc1cc(C=Nn2c(C(C)(C)C)nc3ccc(Br)cc3c2=O)cc(OCC)c1OCc1ccccc1 |
| InChI | InChI=1S/C31H32BrN3O3/c1-6-11-23-16-22(17-27(37-7-2)28(23)38-20-21-12-9-8-10-13-21)19-33-35-29(36)25-18-24(32)14-15-26(25)34-30(35)31(3,4)5/h6,8-10,12-19H,1,7,11,20H2,2-5H3 |
| InChIKey | GXABORLNWXVHDH-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|