C27H23BrIN3O5 — CID 126289030
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-6-bromo-2-ethylquinazolin-4-one (PubChem CID 126289030) has the molecular formula C27H23BrIN3O5 and a molecular weight of 676.31 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-6-bromo-2-ethylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-6-bromo-2-ethylquinazolin-4-one |
|---|---|
| PubChem CID | 126289030 |
| Molecular Formula | C27H23BrIN3O5 |
| Molecular Weight | 676.31 g/mol |
| Exact Mass | 674.99 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-3-ethoxy-5-iodophenyl]methylideneamino]-6-bromo-2-ethylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(CC)nc3ccc(Br)cc3c2=O)cc(I)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H23BrIN3O5/c1-3-25-31-21-7-6-18(28)12-19(21)27(33)32(25)30-13-17-9-20(29)26(24(11-17)34-4-2)35-14-16-5-8-22-23(10-16)37-15-36-22/h5-13H,3-4,14-15H2,1-2H3 |
| InChIKey | PIDJQXSMIJJRRE-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.31 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|