C27H24BrClIN3O3 — CID 126337272
6-bromo-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126337272) has the molecular formula C27H24BrClIN3O3 and a molecular weight of 680.77 g/mol. Its IUPAC name is 6-bromo-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126337272 |
| Molecular Formula | C27H24BrClIN3O3 |
| Molecular Weight | 680.77 g/mol |
| Exact Mass | 678.97 |
| IUPAC Name | 6-bromo-3-[[4-[(4-chlorophenyl)methoxy]-3-ethoxy-5-iodophenyl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(I)c(OCc2ccc(Cl)cc2)c(OCC)c1 |
| InChI | InChI=1S/C27H24BrClIN3O3/c1-3-5-25-32-23-11-8-19(28)14-21(23)27(34)33(25)31-15-18-12-22(30)26(24(13-18)35-4-2)36-16-17-6-9-20(29)10-7-17/h6-15H,3-5,16H2,1-2H3 |
| InChIKey | FAQUEYKZOZIXHE-UHFFFAOYSA-N |
| XLogP | 7.23 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.77 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|