C25H19Br3ClN3O2 — CID 126332346
6-bromo-3-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126332346) has the molecular formula C25H19Br3ClN3O2 and a molecular weight of 668.61 g/mol. Its IUPAC name is 6-bromo-3-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126332346 |
| Molecular Formula | C25H19Br3ClN3O2 |
| Molecular Weight | 668.61 g/mol |
| Exact Mass | 664.87 |
| IUPAC Name | 6-bromo-3-[[3,5-dibromo-4-[(4-chlorophenyl)methoxy]phenyl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(Br)c(OCc2ccc(Cl)cc2)c(Br)c1 |
| InChI | InChI=1S/C25H19Br3ClN3O2/c1-2-3-23-31-22-9-6-17(26)12-19(22)25(33)32(23)30-13-16-10-20(27)24(21(28)11-16)34-14-15-4-7-18(29)8-5-15/h4-13H,2-3,14H2,1H3 |
| InChIKey | IAJAAGDUNNBETB-UHFFFAOYSA-N |
| XLogP | 7.75 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 668.61 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|