C18H15BrClN3O — CID 126328161
6-bromo-3-[(4-chlorophenyl)methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126328161) has the molecular formula C18H15BrClN3O and a molecular weight of 404.70 g/mol. Its IUPAC name is 6-bromo-3-[(4-chlorophenyl)methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[(4-chlorophenyl)methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126328161 |
| Molecular Formula | C18H15BrClN3O |
| Molecular Weight | 404.70 g/mol |
| Exact Mass | 403.01 |
| IUPAC Name | 6-bromo-3-[(4-chlorophenyl)methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H15BrClN3O/c1-2-3-17-22-16-9-6-13(19)10-15(16)18(24)23(17)21-11-12-4-7-14(20)8-5-12/h4-11H,2-3H2,1H3 |
| InChIKey | KGWOVOOOPRUOEY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.70 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|