C19H16BrN3O3 — CID 126333404
3-(1,3-benzodioxol-5-ylmethylideneamino)-6-bromo-2-propylquinazolin-4-one (PubChem CID 126333404) has the molecular formula C19H16BrN3O3 and a molecular weight of 414.26 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylideneamino)-6-bromo-2-propylquinazolin-4-one.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-6-bromo-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126333404 |
| Molecular Formula | C19H16BrN3O3 |
| Molecular Weight | 414.26 g/mol |
| Exact Mass | 413.04 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-6-bromo-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H16BrN3O3/c1-2-3-18-22-15-6-5-13(20)9-14(15)19(24)23(18)21-10-12-4-7-16-17(8-12)26-11-25-16/h4-10H,2-3,11H2,1H3 |
| InChIKey | RUSXPWINHCPEOT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.26 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|