C22H24BrN3O2 — CID 126316193
6-bromo-3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-propylquinazolin-4-one (PubChem CID 126316193) has the molecular formula C22H24BrN3O2 and a molecular weight of 442.36 g/mol. Its IUPAC name is 6-bromo-3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-propylquinazolin-4-one.
| Compound Name | 6-bromo-3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-propylquinazolin-4-one |
|---|---|
| PubChem CID | 126316193 |
| Molecular Formula | C22H24BrN3O2 |
| Molecular Weight | 442.36 g/mol |
| Exact Mass | 441.11 |
| IUPAC Name | 6-bromo-3-[[3-[(2S)-butan-2-yl]oxyphenyl]methylideneamino]-2-propylquinazolin-4-one |
| SMILES | CCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cccc(O[C@@H](C)CC)c1 |
| InChI | InChI=1S/C22H24BrN3O2/c1-4-7-21-25-20-11-10-17(23)13-19(20)22(27)26(21)24-14-16-8-6-9-18(12-16)28-15(3)5-2/h6,8-15H,4-5,7H2,1-3H3/t15-/m0/s1 |
| InChIKey | PMZHAQVQVANPGS-HNNXBMFYSA-N |
| XLogP | 5.17 |
| TPSA | 56.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.36 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|