C29H27Br2N3O5 — CID 126318421
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-6-bromo-2-butylquinazolin-4-one (PubChem CID 126318421) has the molecular formula C29H27Br2N3O5 and a molecular weight of 657.36 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-6-bromo-2-butylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-6-bromo-2-butylquinazolin-4-one |
|---|---|
| PubChem CID | 126318421 |
| Molecular Formula | C29H27Br2N3O5 |
| Molecular Weight | 657.36 g/mol |
| Exact Mass | 655.03 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-6-bromo-2-butylquinazolin-4-one |
| SMILES | CCCCc1nc2ccc(Br)cc2c(=O)n1N=Cc1cc(OCC)c(OCc2ccc3c(c2)OCO3)cc1Br |
| InChI | InChI=1S/C29H27Br2N3O5/c1-3-5-6-28-33-23-9-8-20(30)13-21(23)29(35)34(28)32-15-19-12-26(36-4-2)27(14-22(19)31)37-16-18-7-10-24-25(11-18)39-17-38-24/h7-15H,3-6,16-17H2,1-2H3 |
| InChIKey | KMGCIHLDYWOHEN-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.36 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|