C31H30BrN3O5 — CID 126314576
3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126314576) has the molecular formula C31H30BrN3O5 and a molecular weight of 604.50 g/mol. Its IUPAC name is 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126314576 |
| Molecular Formula | C31H30BrN3O5 |
| Molecular Weight | 604.50 g/mol |
| Exact Mass | 603.14 |
| IUPAC Name | 3-[[4-(1,3-benzodioxol-5-ylmethoxy)-2-bromo-5-ethoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c(Br)cc1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C31H30BrN3O5/c1-2-37-28-15-22(24(32)16-29(28)38-18-20-12-13-26-27(14-20)40-19-39-26)17-33-35-30(21-8-4-3-5-9-21)34-25-11-7-6-10-23(25)31(35)36/h6-7,10-17,21H,2-5,8-9,18-19H2,1H3 |
| InChIKey | XFTCLKNTZOETDI-UHFFFAOYSA-N |
| XLogP | 6.80 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.50 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|