C30H28BrN3O5 — CID 126302946
3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-methoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one (PubChem CID 126302946) has the molecular formula C30H28BrN3O5 and a molecular weight of 590.47 g/mol. Its IUPAC name is 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-methoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one.
| Compound Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-methoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
|---|---|
| PubChem CID | 126302946 |
| Molecular Formula | C30H28BrN3O5 |
| Molecular Weight | 590.47 g/mol |
| Exact Mass | 589.12 |
| IUPAC Name | 3-[[2-(1,3-benzodioxol-5-ylmethoxy)-5-bromo-3-methoxyphenyl]methylideneamino]-2-cyclohexylquinazolin-4-one |
| SMILES | COc1cc(Br)cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c1OCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C30H28BrN3O5/c1-36-27-15-22(31)14-21(28(27)37-17-19-11-12-25-26(13-19)39-18-38-25)16-32-34-29(20-7-3-2-4-8-20)33-24-10-6-5-9-23(24)30(34)35/h5-6,9-16,20H,2-4,7-8,17-18H2,1H3 |
| InChIKey | RLPQSZPWIJJCFB-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 84.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.47 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|