C29H25Br2Cl2N3O3 — CID 126286753
2-cyclohexyl-3-[[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]quinazolin-4-one (PubChem CID 126286753) has the molecular formula C29H25Br2Cl2N3O3 and a molecular weight of 694.25 g/mol. Its IUPAC name is 2-cyclohexyl-3-[[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]quinazolin-4-one.
| Compound Name | 2-cyclohexyl-3-[[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126286753 |
| Molecular Formula | C29H25Br2Cl2N3O3 |
| Molecular Weight | 694.25 g/mol |
| Exact Mass | 690.96 |
| IUPAC Name | 2-cyclohexyl-3-[[2,3-dibromo-4-[(3,4-dichlorophenyl)methoxy]-5-methoxyphenyl]methylideneamino]quinazolin-4-one |
| SMILES | COc1cc(C=Nn2c(C3CCCCC3)nc3ccccc3c2=O)c(Br)c(Br)c1OCc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C29H25Br2Cl2N3O3/c1-38-24-14-19(25(30)26(31)27(24)39-16-17-11-12-21(32)22(33)13-17)15-34-36-28(18-7-3-2-4-8-18)35-23-10-6-5-9-20(23)29(36)37/h5-6,9-15,18H,2-4,7-8,16H2,1H3 |
| InChIKey | JMERSFJFFAQWTD-UHFFFAOYSA-N |
| XLogP | 8.75 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.25 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|