C30H28Br3N3O3 — CID 126323253
6-bromo-2-cyclohexyl-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one (PubChem CID 126323253) has the molecular formula C30H28Br3N3O3 and a molecular weight of 718.28 g/mol. Its IUPAC name is 6-bromo-2-cyclohexyl-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one.
| Compound Name | 6-bromo-2-cyclohexyl-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
|---|---|
| PubChem CID | 126323253 |
| Molecular Formula | C30H28Br3N3O3 |
| Molecular Weight | 718.28 g/mol |
| Exact Mass | 714.97 |
| IUPAC Name | 6-bromo-2-cyclohexyl-3-[(2,3-dibromo-5-ethoxy-4-phenylmethoxyphenyl)methylideneamino]quinazolin-4-one |
| SMILES | CCOc1cc(C=Nn2c(C3CCCCC3)nc3ccc(Br)cc3c2=O)c(Br)c(Br)c1OCc1ccccc1 |
| InChI | InChI=1S/C30H28Br3N3O3/c1-2-38-25-15-21(26(32)27(33)28(25)39-18-19-9-5-3-6-10-19)17-34-36-29(20-11-7-4-8-12-20)35-24-14-13-22(31)16-23(24)30(36)37/h3,5-6,9-10,13-17,20H,2,4,7-8,11-12,18H2,1H3 |
| InChIKey | OCDUERBLVDLHDS-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 65.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 718.28 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|